C10H11N3O2S — CID 58260849
[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methanol (PubChem CID 58260849) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is [5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methanol.
| Compound Name | [5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methanol |
|---|---|
| PubChem CID | 58260849 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | [5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methanol |
| SMILES | COc1ccc(Nc2nnc(CO)s2)cc1 |
| InChI | InChI=1S/C10H11N3O2S/c1-15-8-4-2-7(3-5-8)11-10-13-12-9(6-14)16-10/h2-5,14H,6H2,1H3,(H,11,13) |
| InChIKey | YCGZAAWNUFTHDN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |