C17H18N2O2S — CID 14700312
2-(4-methoxyanilino)-4,5,7-trimethyl-1,3-benzothiazol-6-ol (PubChem CID 14700312) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-4,5,7-trimethyl-1,3-benzothiazol-6-ol.
| Compound Name | 2-(4-methoxyanilino)-4,5,7-trimethyl-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 14700312 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(4-methoxyanilino)-4,5,7-trimethyl-1,3-benzothiazol-6-ol |
| SMILES | COc1ccc(Nc2nc3c(C)c(C)c(O)c(C)c3s2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-9-10(2)15(20)11(3)16-14(9)19-17(22-16)18-12-5-7-13(21-4)8-6-12/h5-8,20H,1-4H3,(H,18,19) |
| InChIKey | UWYBFWJGSZUMDT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |