C24H30N2O2S — CID 139972664
2,6-ditert-butyl-4-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]phenol (PubChem CID 139972664) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 139972664 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]phenol |
| SMILES | COc1ccc(Nc2nc(-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cs2)cc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-23(2,3)18-12-15(13-19(21(18)27)24(4,5)6)20-14-29-22(26-20)25-16-8-10-17(28-7)11-9-16/h8-14,27H,1-7H3,(H,25,26) |
| InChIKey | CXRBKYAKWNKOHE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |