C25H31BrN3O2S- — CID 21179316
2,6-ditert-butyl-4-[2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol bromide (PubChem CID 21179316) has the molecular formula C25H31BrN3O2S- and a molecular weight of 517.51 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol bromide.
| Compound Name | 2,6-ditert-butyl-4-[2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol bromide |
|---|---|
| PubChem CID | 21179316 |
| Molecular Formula | C25H31BrN3O2S- |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol bromide |
| SMILES | COc1ccc(/C=N/Nc2nc(-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cs2)cc1.[Br-] |
| InChI | InChI=1S/C25H31N3O2S.BrH/c1-24(2,3)19-12-17(13-20(22(19)29)25(4,5)6)21-15-31-23(27-21)28-26-14-16-8-10-18(30-7)11-9-16;/h8-15,29H,1-7H3,(H,27,28);1H/p-1/b26-14+; |
| InChIKey | AUHRWHONWKBWBQ-BCUBJXSGSA-M |
| XLogP | 3.57 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|