C18H25NOS — CID 2742347
2,6-ditert-butyl-4-(2-methyl-1,3-thiazol-4-yl)phenol (PubChem CID 2742347) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2-methyl-1,3-thiazol-4-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2-methyl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 2742347 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2,6-ditert-butyl-4-(2-methyl-1,3-thiazol-4-yl)phenol |
| SMILES | Cc1nc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C18H25NOS/c1-11-19-15(10-21-11)12-8-13(17(2,3)4)16(20)14(9-12)18(5,6)7/h8-10,20H,1-7H3 |
| InChIKey | UGKQQIVBLCDMJC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |