C16H24N4O — CID 135492399
4-(3-amino-1H-1,2,4-triazol-5-yl)-2,6-ditert-butylphenol (PubChem CID 135492399) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-(3-amino-1H-1,2,4-triazol-5-yl)-2,6-ditert-butylphenol.
| Compound Name | 4-(3-amino-1H-1,2,4-triazol-5-yl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 135492399 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-(3-amino-1H-1,2,4-triazol-5-yl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(-c2nc(N)n[nH]2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H24N4O/c1-15(2,3)10-7-9(13-18-14(17)20-19-13)8-11(12(10)21)16(4,5)6/h7-8,21H,1-6H3,(H3,17,18,19,20) |
| InChIKey | NWUOPGPOXIAEFS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |