C8H8N4O2 — CID 107703091
5-(3-amino-1H-1,2,4-triazol-5-yl)benzene-1,3-diol (PubChem CID 107703091) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 5-(3-amino-1H-1,2,4-triazol-5-yl)benzene-1,3-diol.
| Compound Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107703091 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)benzene-1,3-diol |
| SMILES | Nc1n[nH]c(-c2cc(O)cc(O)c2)n1 |
| InChI | InChI=1S/C8H8N4O2/c9-8-10-7(11-12-8)4-1-5(13)3-6(14)2-4/h1-3,13-14H,(H3,9,10,11,12) |
| InChIKey | ZRLXHLXBZMZMBN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |