C9H9N5O2 — CID 107703098
5-(4,6-diamino-1,3,5-triazin-2-yl)benzene-1,3-diol (PubChem CID 107703098) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-(4,6-diamino-1,3,5-triazin-2-yl)benzene-1,3-diol.
| Compound Name | 5-(4,6-diamino-1,3,5-triazin-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107703098 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-(4,6-diamino-1,3,5-triazin-2-yl)benzene-1,3-diol |
| SMILES | Nc1nc(N)nc(-c2cc(O)cc(O)c2)n1 |
| InChI | InChI=1S/C9H9N5O2/c10-8-12-7(13-9(11)14-8)4-1-5(15)3-6(16)2-4/h1-3,15-16H,(H4,10,11,12,13,14) |
| InChIKey | IKNZTCJVZFYNBQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |