C28H24N12 — CID 139144277
6-(4-pyridin-4-ylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 139144277) has the molecular formula C28H24N12 and a molecular weight of 528.58 g/mol. Its IUPAC name is 6-(4-pyridin-4-ylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-pyridin-4-ylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139144277 |
| Molecular Formula | C28H24N12 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 6-(4-pyridin-4-ylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccc(-c3ccncc3)cc2)n1.Nc1nc(N)nc(-c2ccc(-c3ccncc3)cc2)n1 |
| InChI | InChI=1S/2C14H12N6/c2*15-13-18-12(19-14(16)20-13)11-3-1-9(2-4-11)10-5-7-17-8-6-10/h2*1-8H,(H4,15,16,18,19,20) |
| InChIKey | PSWZYMLTIFFRJH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 207.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |