C20H13ClN4 — CID 142751330
2-chloro-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine (PubChem CID 142751330) has the molecular formula C20H13ClN4 and a molecular weight of 344.81 g/mol. Its IUPAC name is 2-chloro-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 142751330 |
| Molecular Formula | C20H13ClN4 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-chloro-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc(-c3ccncc3)cc2)n1 |
| InChI | InChI=1S/C20H13ClN4/c21-20-24-18(16-4-2-1-3-5-16)23-19(25-20)17-8-6-14(7-9-17)15-10-12-22-13-11-15/h1-13H |
| InChIKey | DDBRANCSPCTTHZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |