C27H18ClN3 — CID 22476006
2-chloro-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 22476006) has the molecular formula C27H18ClN3 and a molecular weight of 419.92 g/mol. Its IUPAC name is 2-chloro-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 22476006 |
| Molecular Formula | C27H18ClN3 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-chloro-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H18ClN3/c28-27-30-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)29-26(31-27)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
| InChIKey | FVQBRDRAILXTMJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |