C20H28N2OS — CID 11256444
4-[2-(aziridin-1-ylmethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol (PubChem CID 11256444) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is 4-[2-(aziridin-1-ylmethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2-(aziridin-1-ylmethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 11256444 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-[2-(aziridin-1-ylmethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(-c2csc(CN3CC3)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H28N2OS/c1-19(2,3)14-9-13(10-15(18(14)23)20(4,5)6)16-12-24-17(21-16)11-22-7-8-22/h9-10,12,23H,7-8,11H2,1-6H3 |
| InChIKey | HMYIBCGIOIGXEW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|