C21H33ClN2OS — CID 87312849
2,6-ditert-butyl-4-[2-(propylaminomethyl)-1,3-thiazol-4-yl]phenol;hydrochloride (PubChem CID 87312849) has the molecular formula C21H33ClN2OS and a molecular weight of 397.03 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(propylaminomethyl)-1,3-thiazol-4-yl]phenol;hydrochloride.
| Compound Name | 2,6-ditert-butyl-4-[2-(propylaminomethyl)-1,3-thiazol-4-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 87312849 |
| Molecular Formula | C21H33ClN2OS |
| Molecular Weight | 397.03 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(propylaminomethyl)-1,3-thiazol-4-yl]phenol;hydrochloride |
| SMILES | CCCNCc1nc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cs1.Cl |
| InChI | InChI=1S/C21H32N2OS.ClH/c1-8-9-22-12-18-23-17(13-25-18)14-10-15(20(2,3)4)19(24)16(11-14)21(5,6)7;/h10-11,13,22,24H,8-9,12H2,1-7H3;1H |
| InChIKey | PTEFSCLLFYGJRF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|