C20H34N2O — CID 751703
2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)methyl]phenol (PubChem CID 751703) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 751703 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)methyl]phenol |
| SMILES | CN1CCN(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C20H34N2O/c1-19(2,3)16-12-15(13-17(18(16)23)20(4,5)6)14-22-10-8-21(7)9-11-22/h12-13,23H,8-11,14H2,1-7H3 |
| InChIKey | BXSWMSHTCVMDQS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |