C21H35NO — CID 7444975
2,6-ditert-butyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenol (PubChem CID 7444975) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 7444975 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]phenol |
| SMILES | C[C@H]1CCCCN1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H35NO/c1-15-10-8-9-11-22(15)14-16-12-17(20(2,3)4)19(23)18(13-16)21(5,6)7/h12-13,15,23H,8-11,14H2,1-7H3/t15-/m0/s1 |
| InChIKey | DSFVTRCLYACVIR-HNNXBMFYSA-N |
| XLogP | 5.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |