C21H35NO2 — CID 3537388
2,6-ditert-butyl-4-[(2,6-dimethylmorpholin-4-yl)methyl]phenol (PubChem CID 3537388) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2,6-dimethylmorpholin-4-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2,6-dimethylmorpholin-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 3537388 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2,6-dimethylmorpholin-4-yl)methyl]phenol |
| SMILES | CC1CN(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC(C)O1 |
| InChI | InChI=1S/C21H35NO2/c1-14-11-22(12-15(2)24-14)13-16-9-17(20(3,4)5)19(23)18(10-16)21(6,7)8/h9-10,14-15,23H,11-13H2,1-8H3 |
| InChIKey | XFZPFGSKXCPGBO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |