3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid

C16H23NO3 — CID 84758606

IUPAC3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid
SMILESCC1CN(Cc2cccc(CCC(=O)O)c2)CC(C)O1
InChIInChI=1S/C16H23NO3/c1-12-9-17(10-13(2)20-12)11-15-5-3-4-14(8-15)6-7-16(18)19/h3-5,8,12-13H,6-7,9-11H2,1-2H3,(H,18,19)
InChIKeyMQGVPSXLXKBNNH-UHFFFAOYSA-N
MW277.36 g/mol
LogP2.31
Rot. Bonds5

About 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid

3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid (PubChem CID 84758606) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid.

Molecular Properties

Compound Name3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid
PubChem CID84758606
Molecular FormulaC16H23NO3
Molecular Weight277.36 g/mol
Exact Mass277.17
IUPAC Name3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid
SMILESCC1CN(Cc2cccc(CCC(=O)O)c2)CC(C)O1
InChIInChI=1S/C16H23NO3/c1-12-9-17(10-13(2)20-12)11-15-5-3-4-14(8-15)6-7-16(18)19/h3-5,8,12-13H,6-7,9-11H2,1-2H3,(H,18,19)
InChIKeyMQGVPSXLXKBNNH-UHFFFAOYSA-N
XLogP2.31
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.36
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid?
The IUPAC name of 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid (CID 84758606) is 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid.
What is the SMILES notation for 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid?
The canonical SMILES for 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid is CC1CN(Cc2cccc(CCC(=O)O)c2)CC(C)O1.
What is the InChIKey of 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid?
The InChIKey is MQGVPSXLXKBNNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-12-9-17(10-13(2)20-12)11-15-5-3-4-14(8-15)6-7-16(18)19/h3-5,8,12-13H,6-7,9-11H2,1-2H3,(H,18,19).
What are the key properties of 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid?
3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid has a molecular weight of 277.36 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]propanoic acid is sourced from PubChem (CID 84758606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).