C19H28N2OS — CID 3767969
4-(3,5-ditert-butyl-4-ethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 3767969) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-ethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,5-ditert-butyl-4-ethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3767969 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-ethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1c(C(C)(C)C)cc(-c2csc(N)n2)cc1C(C)(C)C |
| InChI | InChI=1S/C19H28N2OS/c1-8-22-16-13(18(2,3)4)9-12(10-14(16)19(5,6)7)15-11-23-17(20)21-15/h9-11H,8H2,1-7H3,(H2,20,21) |
| InChIKey | SBRAAEWAQBZLJQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |