C11H11F2N3S — CID 121006255
4-[4-(dimethylamino)-3,5-difluorophenyl]-1,3-thiazol-2-amine (PubChem CID 121006255) has the molecular formula C11H11F2N3S and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-3,5-difluorophenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(dimethylamino)-3,5-difluorophenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 121006255 |
| Molecular Formula | C11H11F2N3S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-[4-(dimethylamino)-3,5-difluorophenyl]-1,3-thiazol-2-amine |
| SMILES | CN(C)c1c(F)cc(-c2csc(N)n2)cc1F |
| InChI | InChI=1S/C11H11F2N3S/c1-16(2)10-7(12)3-6(4-8(10)13)9-5-17-11(14)15-9/h3-5H,1-2H3,(H2,14,15) |
| InChIKey | GCRCQFLHYPZUNT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |