C9H5BrF2N2S — CID 112562091
4-(4-bromo-2,6-difluorophenyl)-1,3-thiazol-2-amine (PubChem CID 112562091) has the molecular formula C9H5BrF2N2S and a molecular weight of 291.12 g/mol. Its IUPAC name is 4-(4-bromo-2,6-difluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromo-2,6-difluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 112562091 |
| Molecular Formula | C9H5BrF2N2S |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 4-(4-bromo-2,6-difluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2c(F)cc(Br)cc2F)cs1 |
| InChI | InChI=1S/C9H5BrF2N2S/c10-4-1-5(11)8(6(12)2-4)7-3-15-9(13)14-7/h1-3H,(H2,13,14) |
| InChIKey | OSSAPDDZKHENID-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |