C9H5Br2FN2 — CID 138687958
3,7-dibromo-5-fluoroquinolin-2-amine (PubChem CID 138687958) has the molecular formula C9H5Br2FN2 and a molecular weight of 319.96 g/mol. Its IUPAC name is 3,7-dibromo-5-fluoroquinolin-2-amine.
| Compound Name | 3,7-dibromo-5-fluoroquinolin-2-amine |
|---|---|
| PubChem CID | 138687958 |
| Molecular Formula | C9H5Br2FN2 |
| Molecular Weight | 319.96 g/mol |
| Exact Mass | 317.88 |
| IUPAC Name | 3,7-dibromo-5-fluoroquinolin-2-amine |
| SMILES | Nc1nc2cc(Br)cc(F)c2cc1Br |
| InChI | InChI=1S/C9H5Br2FN2/c10-4-1-7(12)5-3-6(11)9(13)14-8(5)2-4/h1-3H,(H2,13,14) |
| InChIKey | IVDLSWCLXKRNSR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.96 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |