C14H9BrF2N4 — CID 102986610
3-N-(4-bromo-2,6-difluorophenyl)quinoxaline-2,3-diamine (PubChem CID 102986610) has the molecular formula C14H9BrF2N4 and a molecular weight of 351.15 g/mol. Its IUPAC name is 3-N-(4-bromo-2,6-difluorophenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(4-bromo-2,6-difluorophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102986610 |
| Molecular Formula | C14H9BrF2N4 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-N-(4-bromo-2,6-difluorophenyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H9BrF2N4/c15-7-5-8(16)12(9(17)6-7)21-14-13(18)19-10-3-1-2-4-11(10)20-14/h1-6H,(H2,18,19)(H,20,21) |
| InChIKey | RJFIYIXKAHWJCE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |