C14H10ClFN4 — CID 102983660
3-N-(3-chloro-4-fluorophenyl)quinoxaline-2,3-diamine (PubChem CID 102983660) has the molecular formula C14H10ClFN4 and a molecular weight of 288.71 g/mol. Its IUPAC name is 3-N-(3-chloro-4-fluorophenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(3-chloro-4-fluorophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102983660 |
| Molecular Formula | C14H10ClFN4 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-N-(3-chloro-4-fluorophenyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN4/c15-9-7-8(5-6-10(9)16)18-14-13(17)19-11-3-1-2-4-12(11)20-14/h1-7H,(H2,17,19)(H,18,20) |
| InChIKey | YNFYHNADJBGLNY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |