C11H7Cl2F2N3 — CID 102755062
3,5-dichloro-6-N-(3,4-difluorophenyl)pyridine-2,6-diamine (PubChem CID 102755062) has the molecular formula C11H7Cl2F2N3 and a molecular weight of 290.10 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(3,4-difluorophenyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(3,4-difluorophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755062 |
| Molecular Formula | C11H7Cl2F2N3 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 3,5-dichloro-6-N-(3,4-difluorophenyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(F)c(F)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H7Cl2F2N3/c12-6-4-7(13)11(18-10(6)16)17-5-1-2-8(14)9(15)3-5/h1-4H,(H3,16,17,18) |
| InChIKey | RFIWGTJSFONPJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |