C11H8BrCl2N3 — CID 102755131
6-N-(4-bromophenyl)-3,5-dichloropyridine-2,6-diamine (PubChem CID 102755131) has the molecular formula C11H8BrCl2N3 and a molecular weight of 333.02 g/mol. Its IUPAC name is 6-N-(4-bromophenyl)-3,5-dichloropyridine-2,6-diamine.
| Compound Name | 6-N-(4-bromophenyl)-3,5-dichloropyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755131 |
| Molecular Formula | C11H8BrCl2N3 |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 6-N-(4-bromophenyl)-3,5-dichloropyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(Br)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H8BrCl2N3/c12-6-1-3-7(4-2-6)16-11-9(14)5-8(13)10(15)17-11/h1-5H,(H3,15,16,17) |
| InChIKey | PVBTWNJIYZJLPF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |