C12H10BrClN2 — CID 62913398
4-N-(5-bromo-2-chlorophenyl)benzene-1,4-diamine (PubChem CID 62913398) has the molecular formula C12H10BrClN2 and a molecular weight of 297.58 g/mol. Its IUPAC name is 4-N-(5-bromo-2-chlorophenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(5-bromo-2-chlorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 62913398 |
| Molecular Formula | C12H10BrClN2 |
| Molecular Weight | 297.58 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 4-N-(5-bromo-2-chlorophenyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2cc(Br)ccc2Cl)cc1 |
| InChI | InChI=1S/C12H10BrClN2/c13-8-1-6-11(14)12(7-8)16-10-4-2-9(15)3-5-10/h1-7,16H,15H2 |
| InChIKey | LLCWTXGVJYAHNC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|