C13H14Cl2N4 — CID 102756297
3,5-dichloro-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-diamine (PubChem CID 102756297) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 3,5-dichloro-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102756297 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3,5-dichloro-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(N)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H14Cl2N4/c1-19(2)9-5-3-8(4-6-9)17-13-11(15)7-10(14)12(16)18-13/h3-7H,1-2H3,(H3,16,17,18) |
| InChIKey | XJIDMVVTCQRKGZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|