C13H15ClN4 — CID 79021909
5-chloro-2-N-[4-(dimethylamino)phenyl]pyridine-2,3-diamine (PubChem CID 79021909) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 5-chloro-2-N-[4-(dimethylamino)phenyl]pyridine-2,3-diamine.
| Compound Name | 5-chloro-2-N-[4-(dimethylamino)phenyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79021909 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-chloro-2-N-[4-(dimethylamino)phenyl]pyridine-2,3-diamine |
| SMILES | CN(C)c1ccc(Nc2ncc(Cl)cc2N)cc1 |
| InChI | InChI=1S/C13H15ClN4/c1-18(2)11-5-3-10(4-6-11)17-13-12(15)7-9(14)8-16-13/h3-8H,15H2,1-2H3,(H,16,17) |
| InChIKey | HAUJXQHPBNFQSQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|