C11H7BrCl3N3 — CID 114001533
2-N-(4-bromo-2,3-dichlorophenyl)-5-chloropyridine-2,3-diamine (PubChem CID 114001533) has the molecular formula C11H7BrCl3N3 and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-N-(4-bromo-2,3-dichlorophenyl)-5-chloropyridine-2,3-diamine.
| Compound Name | 2-N-(4-bromo-2,3-dichlorophenyl)-5-chloropyridine-2,3-diamine |
|---|---|
| PubChem CID | 114001533 |
| Molecular Formula | C11H7BrCl3N3 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 364.89 |
| IUPAC Name | 2-N-(4-bromo-2,3-dichlorophenyl)-5-chloropyridine-2,3-diamine |
| SMILES | Nc1cc(Cl)cnc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H7BrCl3N3/c12-6-1-2-8(10(15)9(6)14)18-11-7(16)3-5(13)4-17-11/h1-4H,16H2,(H,17,18) |
| InChIKey | IGOPFUGVKHTJTN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|