C11H7BrCl3N3O — CID 107792305
N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methoxypyrimidin-4-amine (PubChem CID 107792305) has the molecular formula C11H7BrCl3N3O and a molecular weight of 383.46 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methoxypyrimidin-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 107792305 |
| Molecular Formula | C11H7BrCl3N3O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 380.88 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methoxypyrimidin-4-amine |
| SMILES | COc1c(Cl)ncnc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H7BrCl3N3O/c1-19-9-10(15)16-4-17-11(9)18-6-3-2-5(12)7(13)8(6)14/h2-4H,1H3,(H,16,17,18) |
| InChIKey | LRVYKBXDICYOJL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|