C8H3BrCl3N3S — CID 107792312
N-(4-bromo-2,3-dichlorophenyl)-4-chloro-1,2,5-thiadiazol-3-amine (PubChem CID 107792312) has the molecular formula C8H3BrCl3N3S and a molecular weight of 359.46 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-4-chloro-1,2,5-thiadiazol-3-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-4-chloro-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 107792312 |
| Molecular Formula | C8H3BrCl3N3S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 356.83 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-4-chloro-1,2,5-thiadiazol-3-amine |
| SMILES | Clc1nsnc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3BrCl3N3S/c9-3-1-2-4(6(11)5(3)10)13-8-7(12)14-16-15-8/h1-2H,(H,13,15) |
| InChIKey | XKXBJBOGISNXFS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|