C8H4BrClIN3S — CID 130499509
N-(2-bromo-4-iodophenyl)-4-chloro-1,2,5-thiadiazol-3-amine (PubChem CID 130499509) has the molecular formula C8H4BrClIN3S and a molecular weight of 416.47 g/mol. Its IUPAC name is N-(2-bromo-4-iodophenyl)-4-chloro-1,2,5-thiadiazol-3-amine.
| Compound Name | N-(2-bromo-4-iodophenyl)-4-chloro-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 130499509 |
| Molecular Formula | C8H4BrClIN3S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 414.80 |
| IUPAC Name | N-(2-bromo-4-iodophenyl)-4-chloro-1,2,5-thiadiazol-3-amine |
| SMILES | Clc1nsnc1Nc1ccc(I)cc1Br |
| InChI | InChI=1S/C8H4BrClIN3S/c9-5-3-4(11)1-2-6(5)12-8-7(10)13-15-14-8/h1-3H,(H,12,14) |
| InChIKey | QDFMBXVVDOOZCH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|