C11H7BrCl2IN3 — CID 114261721
6-N-(2-bromo-4-iodophenyl)-3,5-dichloropyridine-2,6-diamine (PubChem CID 114261721) has the molecular formula C11H7BrCl2IN3 and a molecular weight of 458.91 g/mol. Its IUPAC name is 6-N-(2-bromo-4-iodophenyl)-3,5-dichloropyridine-2,6-diamine.
| Compound Name | 6-N-(2-bromo-4-iodophenyl)-3,5-dichloropyridine-2,6-diamine |
|---|---|
| PubChem CID | 114261721 |
| Molecular Formula | C11H7BrCl2IN3 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 456.82 |
| IUPAC Name | 6-N-(2-bromo-4-iodophenyl)-3,5-dichloropyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(I)cc2Br)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H7BrCl2IN3/c12-6-3-5(15)1-2-9(6)17-11-8(14)4-7(13)10(16)18-11/h1-4H,(H3,16,17,18) |
| InChIKey | YQZIUUCGQDBGGE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|