C11H4BrCl5N2 — CID 114002020
N-(4-bromo-2,3-dichlorophenyl)-3,5,6-trichloropyridin-2-amine (PubChem CID 114002020) has the molecular formula C11H4BrCl5N2 and a molecular weight of 421.34 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-3,5,6-trichloropyridin-2-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-3,5,6-trichloropyridin-2-amine |
|---|---|
| PubChem CID | 114002020 |
| Molecular Formula | C11H4BrCl5N2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 417.80 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-3,5,6-trichloropyridin-2-amine |
| SMILES | Clc1cc(Cl)c(Nc2ccc(Br)c(Cl)c2Cl)nc1Cl |
| InChI | InChI=1S/C11H4BrCl5N2/c12-4-1-2-7(9(16)8(4)15)18-11-6(14)3-5(13)10(17)19-11/h1-3H,(H,18,19) |
| InChIKey | KUQMTCWNYANMMK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|