C14H13BrCl3N3 — CID 107792299
N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 107792299) has the molecular formula C14H13BrCl3N3 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107792299 |
| Molecular Formula | C14H13BrCl3N3 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H13BrCl3N3/c1-6(2)13-20-12(18)7(3)14(21-13)19-9-5-4-8(15)10(16)11(9)17/h4-6H,1-3H3,(H,19,20,21) |
| InChIKey | WMCFFGKTDKTXJY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|