C14H13Cl4N3 — CID 80973856
6-chloro-5-methyl-2-propan-2-yl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine (PubChem CID 80973856) has the molecular formula C14H13Cl4N3 and a molecular weight of 365.09 g/mol. Its IUPAC name is 6-chloro-5-methyl-2-propan-2-yl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-2-propan-2-yl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80973856 |
| Molecular Formula | C14H13Cl4N3 |
| Molecular Weight | 365.09 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 6-chloro-5-methyl-2-propan-2-yl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl4N3/c1-6(2)13-20-12(18)7(3)14(21-13)19-11-5-9(16)8(15)4-10(11)17/h4-6H,1-3H3,(H,19,20,21) |
| InChIKey | OZMRTFXQRVHCLQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.09 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|