C13H11Cl4N3 — CID 80973855
6-chloro-2-ethyl-5-methyl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine (PubChem CID 80973855) has the molecular formula C13H11Cl4N3 and a molecular weight of 351.06 g/mol. Its IUPAC name is 6-chloro-2-ethyl-5-methyl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-5-methyl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80973855 |
| Molecular Formula | C13H11Cl4N3 |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 6-chloro-2-ethyl-5-methyl-N-(2,4,5-trichlorophenyl)pyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(Nc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H11Cl4N3/c1-3-11-19-12(17)6(2)13(20-11)18-10-5-8(15)7(14)4-9(10)16/h4-5H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | VDLIXIKULDJYNW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|