C9H14ClN3 — CID 79557526
6-chloro-N,2-diethyl-5-methylpyrimidin-4-amine (PubChem CID 79557526) has the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. Its IUPAC name is 6-chloro-N,2-diethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N,2-diethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79557526 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 6-chloro-N,2-diethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(CC)nc(Cl)c1C |
| InChI | InChI=1S/C9H14ClN3/c1-4-7-12-8(10)6(3)9(13-7)11-5-2/h4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | VYGFDXJDKCTOOB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |