C11H19ClN4O2S — CID 106341566
2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide (PubChem CID 106341566) has the molecular formula C11H19ClN4O2S and a molecular weight of 306.82 g/mol. Its IUPAC name is 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106341566 |
| Molecular Formula | C11H19ClN4O2S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1nc(CC)nc(Cl)c1C |
| InChI | InChI=1S/C11H19ClN4O2S/c1-4-9-15-10(12)8(3)11(16-9)13-6-7-19(17,18)14-5-2/h14H,4-7H2,1-3H3,(H,13,15,16) |
| InChIKey | CKPPFIYUWDAWED-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |