C12H20ClN3OS — CID 115715788
6-chloro-2-ethyl-5-methyl-N-(3-methylsulfinylbutyl)pyrimidin-4-amine (PubChem CID 115715788) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is 6-chloro-2-ethyl-5-methyl-N-(3-methylsulfinylbutyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-5-methyl-N-(3-methylsulfinylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115715788 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 6-chloro-2-ethyl-5-methyl-N-(3-methylsulfinylbutyl)pyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(NCCC(C)S(C)=O)n1 |
| InChI | InChI=1S/C12H20ClN3OS/c1-5-10-15-11(13)9(3)12(16-10)14-7-6-8(2)18(4)17/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | HITMZAQRFVLNQJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |