C12H20ClN3O2S — CID 80972477
6-chloro-5-methyl-N-(3-methylsulfonylpropyl)-2-propylpyrimidin-4-amine (PubChem CID 80972477) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(3-methylsulfonylpropyl)-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(3-methylsulfonylpropyl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80972477 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 6-chloro-5-methyl-N-(3-methylsulfonylpropyl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)c(C)c(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H20ClN3O2S/c1-4-6-10-15-11(13)9(2)12(16-10)14-7-5-8-19(3,17)18/h4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | MWGNKDDMJXALIO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|