About 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide
2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide (PubChem CID 106341600) has the molecular formula C6H11ClN4O2S2
and a molecular weight of 270.77 g/mol. Its IUPAC name is 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide.
Molecular Properties
| Compound Name | 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide |
| PubChem CID | 106341600 |
| Molecular Formula | C6H11ClN4O2S2 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1nsnc1Cl |
| InChI | InChI=1S/C6H11ClN4O2S2/c1-2-9-15(12,13)4-3-8-6-5(7)10-14-11-6/h9H,2-4H2,1H3,(H,8,11) |
| InChIKey | AYBOPBDXILYYGI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide?
The IUPAC name of 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide (CID 106341600) is 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide.
What is the SMILES notation for 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide?
The canonical SMILES for 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide is CCNS(=O)(=O)CCNc1nsnc1Cl.
What is the InChIKey of 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide?
The InChIKey is AYBOPBDXILYYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClN4O2S2/c1-2-9-15(12,13)4-3-8-6-5(7)10-14-11-6/h9H,2-4H2,1H3,(H,8,11).
What are the key properties of 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide?
2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide has a molecular weight of 270.77 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]-N-ethylethanesulfonamide is sourced from PubChem (CID 106341600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).