C13H12ClFIN3 — CID 114260994
6-chloro-2-ethyl-N-(3-fluoro-2-iodophenyl)-5-methylpyrimidin-4-amine (PubChem CID 114260994) has the molecular formula C13H12ClFIN3 and a molecular weight of 391.62 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-(3-fluoro-2-iodophenyl)-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-N-(3-fluoro-2-iodophenyl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114260994 |
| Molecular Formula | C13H12ClFIN3 |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 6-chloro-2-ethyl-N-(3-fluoro-2-iodophenyl)-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(Nc2cccc(F)c2I)n1 |
| InChI | InChI=1S/C13H12ClFIN3/c1-3-10-18-12(14)7(2)13(19-10)17-9-6-4-5-8(15)11(9)16/h4-6H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | XWNSKVBYXBGNQX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|