C12H7BrCl3FN2 — CID 102752038
N-(4-bromo-5-fluoro-2-methylphenyl)-3,5,6-trichloropyridin-2-amine (PubChem CID 102752038) has the molecular formula C12H7BrCl3FN2 and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-methylphenyl)-3,5,6-trichloropyridin-2-amine.
| Compound Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3,5,6-trichloropyridin-2-amine |
|---|---|
| PubChem CID | 102752038 |
| Molecular Formula | C12H7BrCl3FN2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 381.88 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3,5,6-trichloropyridin-2-amine |
| SMILES | Cc1cc(Br)c(F)cc1Nc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H7BrCl3FN2/c1-5-2-6(13)9(17)4-10(5)18-12-8(15)3-7(14)11(16)19-12/h2-4H,1H3,(H,18,19) |
| InChIKey | QUIRROUVNZCSTR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|