C11H2Cl3F5N2 — CID 102751650
3,5,6-trichloro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine (PubChem CID 102751650) has the molecular formula C11H2Cl3F5N2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751650 |
| Molecular Formula | C11H2Cl3F5N2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 3,5,6-trichloro-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
| SMILES | Fc1c(F)c(F)c(Nc2nc(Cl)c(Cl)cc2Cl)c(F)c1F |
| InChI | InChI=1S/C11H2Cl3F5N2/c12-2-1-3(13)11(21-10(2)14)20-9-7(18)5(16)4(15)6(17)8(9)19/h1H,(H,20,21) |
| InChIKey | LVOAHXNPHAJTGR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|