C11H7Cl2F3N4 — CID 102762228
3,5-dichloro-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyridin-2-amine (PubChem CID 102762228) has the molecular formula C11H7Cl2F3N4 and a molecular weight of 323.11 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102762228 |
| Molecular Formula | C11H7Cl2F3N4 |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyridin-2-amine |
| SMILES | NNc1nc(Nc2c(F)cc(F)cc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H7Cl2F3N4/c12-5-3-6(13)11(20-17)19-10(5)18-9-7(15)1-4(14)2-8(9)16/h1-3H,17H2,(H2,18,19,20) |
| InChIKey | QCIMXRYQBBXRNM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|