C12H12ClF2N5 — CID 83083447
N-(2-chloro-4,6-difluorophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine (PubChem CID 83083447) has the molecular formula C12H12ClF2N5 and a molecular weight of 299.71 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83083447 |
| Molecular Formula | C12H12ClF2N5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H12ClF2N5/c1-2-7-11(17-5-18-12(7)20-16)19-10-8(13)3-6(14)4-9(10)15/h3-5H,2,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | XAZYFNFZPCIQMI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|