C12H13ClIN5 — CID 107604941
N-(2-chloro-4-iodophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine (PubChem CID 107604941) has the molecular formula C12H13ClIN5 and a molecular weight of 389.63 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-chloro-4-iodophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107604941 |
| Molecular Formula | C12H13ClIN5 |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H13ClIN5/c1-2-8-11(16-6-17-12(8)19-15)18-10-4-3-7(14)5-9(10)13/h3-6H,2,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | QVBDWKGIJGKFBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|