C15H14ClIN4 — CID 107606703
3-(2-chloro-4-iodoanilino)-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 107606703) has the molecular formula C15H14ClIN4 and a molecular weight of 412.66 g/mol. Its IUPAC name is 3-(2-chloro-4-iodoanilino)-5,6-diethylpyridazine-4-carbonitrile.
| Compound Name | 3-(2-chloro-4-iodoanilino)-5,6-diethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 107606703 |
| Molecular Formula | C15H14ClIN4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 3-(2-chloro-4-iodoanilino)-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(Nc2ccc(I)cc2Cl)c(C#N)c1CC |
| InChI | InChI=1S/C15H14ClIN4/c1-3-10-11(8-18)15(21-20-13(10)4-2)19-14-6-5-9(17)7-12(14)16/h5-7H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | PPJLPLMOHVEACO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|