C12H11ClF2N4 — CID 83082644
4-N-(2-chloro-4,6-difluorophenyl)-5-ethylpyrimidine-4,6-diamine (PubChem CID 83082644) has the molecular formula C12H11ClF2N4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 4-N-(2-chloro-4,6-difluorophenyl)-5-ethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-chloro-4,6-difluorophenyl)-5-ethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 83082644 |
| Molecular Formula | C12H11ClF2N4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-N-(2-chloro-4,6-difluorophenyl)-5-ethylpyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H11ClF2N4/c1-2-7-11(16)17-5-18-12(7)19-10-8(13)3-6(14)4-9(10)15/h3-5H,2H2,1H3,(H3,16,17,18,19) |
| InChIKey | CLLYIZGGIRRJQA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |